C13H26N2O4S2 — CID 162171819
2-[(2R)-2-amino-3-oxobutyl]sulfanylethyl propanoate;(3R)-3-amino-4-sulfanylbutan-2-one (PubChem CID 162171819) has the molecular formula C13H26N2O4S2 and a molecular weight of 338.50 g/mol. Its IUPAC name is 2-[(2R)-2-amino-3-oxobutyl]sulfanylethyl propanoate;(3R)-3-amino-4-sulfanylbutan-2-one.
| Compound Name | 2-[(2R)-2-amino-3-oxobutyl]sulfanylethyl propanoate;(3R)-3-amino-4-sulfanylbutan-2-one |
|---|---|
| PubChem CID | 162171819 |
| Molecular Formula | C13H26N2O4S2 |
| Molecular Weight | 338.50 g/mol |
| Exact Mass | 338.13 |
| IUPAC Name | 2-[(2R)-2-amino-3-oxobutyl]sulfanylethyl propanoate;(3R)-3-amino-4-sulfanylbutan-2-one |
| SMILES | CC(=O)[C@@H](N)CS.CCC(=O)OCCSC[C@H](N)C(C)=O |
| InChI | InChI=1S/C9H17NO3S.C4H9NOS/c1-3-9(12)13-4-5-14-6-8(10)7(2)11;1-3(6)4(5)2-7/h8H,3-6,10H2,1-2H3;4,7H,2,5H2,1H3/t8-;4-/m00/s1 |
| InChIKey | ZNWXDRZPUISPHT-IPIKRLCPSA-N |
| XLogP | 0.42 |
| TPSA | 112.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.50 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|