C25H30F2N2O — CID 162172489
N-[(8R,9S,10R,13S,14S)-17-[5-(difluoromethyl)-3-pyridinyl]-10,13-dimethyl-1,2,6,7,8,9,11,12,14,15-decahydrocyclopenta[a]phenanthren-3-ylidene]hydroxylamine (PubChem CID 162172489) has the molecular formula C25H30F2N2O and a molecular weight of 412.52 g/mol. Its IUPAC name is N-[(8R,9S,10R,13S,14S)-17-[5-(difluoromethyl)-3-pyridinyl]-10,13-dimethyl-1,2,6,7,8,9,11,12,14,15-decahydrocyclopenta[a]phenanthren-3-ylidene]hydroxylamine.
| Compound Name | N-[(8R,9S,10R,13S,14S)-17-[5-(difluoromethyl)-3-pyridinyl]-10,13-dimethyl-1,2,6,7,8,9,11,12,14,15-decahydrocyclopenta[a]phenanthren-3-ylidene]hydroxylamine |
|---|---|
| PubChem CID | 162172489 |
| Molecular Formula | C25H30F2N2O |
| Molecular Weight | 412.52 g/mol |
| Exact Mass | 412.23 |
| IUPAC Name | N-[(8R,9S,10R,13S,14S)-17-[5-(difluoromethyl)-3-pyridinyl]-10,13-dimethyl-1,2,6,7,8,9,11,12,14,15-decahydrocyclopenta[a]phenanthren-3-ylidene]hydroxylamine |
| SMILES | C[C@]12CCC(=NO)C=C1CC[C@@H]1[C@@H]2CC[C@]2(C)C(c3cncc(C(F)F)c3)=CC[C@@H]12 |
| InChI | InChI=1S/C25H30F2N2O/c1-24-9-7-18(29-30)12-17(24)3-4-19-21-6-5-20(25(21,2)10-8-22(19)24)15-11-16(23(26)27)14-28-13-15/h5,11-14,19,21-23,30H,3-4,6-10H2,1-2H3/t19-,21-,22-,24-,25+/m0/s1 |
| InChIKey | IMATUHUCEQGUOL-JILANQSISA-N |
| XLogP | 6.81 |
| TPSA | 45.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.52 |
| LogP ≤ 5 | 6.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|