C29H39N3O3 — CID 174343708
2-(dimethylamino)ethyl [[(8S,9S,10R,13S,14S)-10,13-dimethyl-17-pyridin-3-yl-1,2,6,7,8,9,11,12,14,15-decahydrocyclopenta[a]phenanthren-3-ylidene]amino] carbonate (PubChem CID 174343708) has the molecular formula C29H39N3O3 and a molecular weight of 477.65 g/mol. Its IUPAC name is 2-(dimethylamino)ethyl [[(8S,9S,10R,13S,14S)-10,13-dimethyl-17-pyridin-3-yl-1,2,6,7,8,9,11,12,14,15-decahydrocyclopenta[a]phenanthren-3-ylidene]amino] carbonate.
| Compound Name | 2-(dimethylamino)ethyl [[(8S,9S,10R,13S,14S)-10,13-dimethyl-17-pyridin-3-yl-1,2,6,7,8,9,11,12,14,15-decahydrocyclopenta[a]phenanthren-3-ylidene]amino] carbonate |
|---|---|
| PubChem CID | 174343708 |
| Molecular Formula | C29H39N3O3 |
| Molecular Weight | 477.65 g/mol |
| Exact Mass | 477.30 |
| IUPAC Name | 2-(dimethylamino)ethyl [[(8S,9S,10R,13S,14S)-10,13-dimethyl-17-pyridin-3-yl-1,2,6,7,8,9,11,12,14,15-decahydrocyclopenta[a]phenanthren-3-ylidene]amino] carbonate |
| SMILES | CN(C)CCOC(=O)ON=C1C=C2CC[C@H]3[C@H](CC[C@]4(C)C(c5cccnc5)=CC[C@@H]34)[C@@]2(C)CC1 |
| InChI | InChI=1S/C29H39N3O3/c1-28-13-11-22(31-35-27(33)34-17-16-32(3)4)18-21(28)7-8-23-25-10-9-24(20-6-5-15-30-19-20)29(25,2)14-12-26(23)28/h5-6,9,15,18-19,23,25-26H,7-8,10-14,16-17H2,1-4H3/t23-,25+,26+,28+,29-/m1/s1 |
| InChIKey | NLUTYUIEJAKNOU-KLFBQTBTSA-N |
| XLogP | 6.11 |
| TPSA | 64.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.65 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|