C30H42N4O2 — CID 174343653
[[(8S,9S,10R,13S,14S)-10,13-dimethyl-17-pyridin-3-yl-1,2,6,7,8,9,11,12,14,15-decahydrocyclopenta[a]phenanthren-3-ylidene]amino] N-[2-(dimethylamino)ethyl]-N-methylcarbamate (PubChem CID 174343653) has the molecular formula C30H42N4O2 and a molecular weight of 490.69 g/mol. Its IUPAC name is [[(8S,9S,10R,13S,14S)-10,13-dimethyl-17-pyridin-3-yl-1,2,6,7,8,9,11,12,14,15-decahydrocyclopenta[a]phenanthren-3-ylidene]amino] N-[2-(dimethylamino)ethyl]-N-methylcarbamate.
| Compound Name | [[(8S,9S,10R,13S,14S)-10,13-dimethyl-17-pyridin-3-yl-1,2,6,7,8,9,11,12,14,15-decahydrocyclopenta[a]phenanthren-3-ylidene]amino] N-[2-(dimethylamino)ethyl]-N-methylcarbamate |
|---|---|
| PubChem CID | 174343653 |
| Molecular Formula | C30H42N4O2 |
| Molecular Weight | 490.69 g/mol |
| Exact Mass | 490.33 |
| IUPAC Name | [[(8S,9S,10R,13S,14S)-10,13-dimethyl-17-pyridin-3-yl-1,2,6,7,8,9,11,12,14,15-decahydrocyclopenta[a]phenanthren-3-ylidene]amino] N-[2-(dimethylamino)ethyl]-N-methylcarbamate |
| SMILES | CN(C)CCN(C)C(=O)ON=C1C=C2CC[C@H]3[C@H](CC[C@]4(C)C(c5cccnc5)=CC[C@@H]34)[C@@]2(C)CC1 |
| InChI | InChI=1S/C30H42N4O2/c1-29-14-12-23(32-36-28(35)34(5)18-17-33(3)4)19-22(29)8-9-24-26-11-10-25(21-7-6-16-31-20-21)30(26,2)15-13-27(24)29/h6-7,10,16,19-20,24,26-27H,8-9,11-15,17-18H2,1-5H3/t24-,26+,27+,29+,30-/m1/s1 |
| InChIKey | GZDQJBFHSAUMNM-FKPLOFJISA-N |
| XLogP | 6.02 |
| TPSA | 58.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.69 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|