C33H40N2O2 — CID 174344443
[[(8S,9S,10R,13S,14S)-10,13-dimethyl-17-pyridin-3-yl-2,3,6,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-3-yl]methylamino] 2-phenylacetate (PubChem CID 174344443) has the molecular formula C33H40N2O2 and a molecular weight of 496.70 g/mol. Its IUPAC name is [[(8S,9S,10R,13S,14S)-10,13-dimethyl-17-pyridin-3-yl-2,3,6,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-3-yl]methylamino] 2-phenylacetate.
| Compound Name | [[(8S,9S,10R,13S,14S)-10,13-dimethyl-17-pyridin-3-yl-2,3,6,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-3-yl]methylamino] 2-phenylacetate |
|---|---|
| PubChem CID | 174344443 |
| Molecular Formula | C33H40N2O2 |
| Molecular Weight | 496.70 g/mol |
| Exact Mass | 496.31 |
| IUPAC Name | [[(8S,9S,10R,13S,14S)-10,13-dimethyl-17-pyridin-3-yl-2,3,6,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-3-yl]methylamino] 2-phenylacetate |
| SMILES | C[C@]12CCC(CNOC(=O)Cc3ccccc3)C=C1CC[C@H]1[C@@H]2CC[C@]2(C)C(c3cccnc3)=CC[C@@H]12 |
| InChI | InChI=1S/C33H40N2O2/c1-32-16-14-24(21-35-37-31(36)20-23-7-4-3-5-8-23)19-26(32)10-11-27-29-13-12-28(25-9-6-18-34-22-25)33(29,2)17-15-30(27)32/h3-9,12,18-19,22,24,27,29-30,35H,10-11,13-17,20-21H2,1-2H3/t24?,27-,29+,30+,32+,33-/m1/s1 |
| InChIKey | DBIGUXQOGYHMIB-DEEQLPEGSA-N |
| XLogP | 6.94 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.70 |
| LogP ≤ 5 | 6.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|