C35H49N3O2 — CID 174344793
[[(8S,9S,10R,13S,14S)-3,10,13-trimethyl-17-pyridin-3-yl-1,2,6,7,8,9,11,12,14,15-decahydrocyclopenta[a]phenanthren-3-yl]amino] 1-(cyclopropylmethyl)piperidine-4-carboxylate (PubChem CID 174344793) has the molecular formula C35H49N3O2 and a molecular weight of 543.80 g/mol. Its IUPAC name is [[(8S,9S,10R,13S,14S)-3,10,13-trimethyl-17-pyridin-3-yl-1,2,6,7,8,9,11,12,14,15-decahydrocyclopenta[a]phenanthren-3-yl]amino] 1-(cyclopropylmethyl)piperidine-4-carboxylate.
| Compound Name | [[(8S,9S,10R,13S,14S)-3,10,13-trimethyl-17-pyridin-3-yl-1,2,6,7,8,9,11,12,14,15-decahydrocyclopenta[a]phenanthren-3-yl]amino] 1-(cyclopropylmethyl)piperidine-4-carboxylate |
|---|---|
| PubChem CID | 174344793 |
| Molecular Formula | C35H49N3O2 |
| Molecular Weight | 543.80 g/mol |
| Exact Mass | 543.38 |
| IUPAC Name | [[(8S,9S,10R,13S,14S)-3,10,13-trimethyl-17-pyridin-3-yl-1,2,6,7,8,9,11,12,14,15-decahydrocyclopenta[a]phenanthren-3-yl]amino] 1-(cyclopropylmethyl)piperidine-4-carboxylate |
| SMILES | CC1(NOC(=O)C2CCN(CC3CC3)CC2)C=C2CC[C@H]3[C@H](CC[C@]4(C)C(c5cccnc5)=CC[C@@H]34)[C@@]2(C)CC1 |
| InChI | InChI=1S/C35H49N3O2/c1-33(37-40-32(39)25-13-19-38(20-14-25)23-24-6-7-24)16-17-34(2)27(21-33)8-9-28-30-11-10-29(26-5-4-18-36-22-26)35(30,3)15-12-31(28)34/h4-5,10,18,21-22,24-25,28,30-31,37H,6-9,11-17,19-20,23H2,1-3H3/t28-,30+,31+,33?,34+,35-/m1/s1 |
| InChIKey | IBHPNTRRXOOYRJ-VMOZUCOQSA-N |
| XLogP | 6.97 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.80 |
| LogP ≤ 5 | 6.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|