C35H43N3O2 — CID 145087929
[(9S,14S)-10,13-dimethyl-17-pyridin-3-yl-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-3-yl] 1-pyridin-3-ylpiperidine-4-carboxylate (PubChem CID 145087929) has the molecular formula C35H43N3O2 and a molecular weight of 537.75 g/mol. Its IUPAC name is [(9S,14S)-10,13-dimethyl-17-pyridin-3-yl-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-3-yl] 1-pyridin-3-ylpiperidine-4-carboxylate.
| Compound Name | [(9S,14S)-10,13-dimethyl-17-pyridin-3-yl-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-3-yl] 1-pyridin-3-ylpiperidine-4-carboxylate |
|---|---|
| PubChem CID | 145087929 |
| Molecular Formula | C35H43N3O2 |
| Molecular Weight | 537.75 g/mol |
| Exact Mass | 537.34 |
| IUPAC Name | [(9S,14S)-10,13-dimethyl-17-pyridin-3-yl-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-3-yl] 1-pyridin-3-ylpiperidine-4-carboxylate |
| SMILES | CC12CCC(OC(=O)C3CCN(c4cccnc4)CC3)CC1=CCC1[C@@H]2CCC2(C)C(c3cccnc3)=CC[C@@H]12 |
| InChI | InChI=1S/C35H43N3O2/c1-34-15-11-28(40-33(39)24-13-19-38(20-14-24)27-6-4-18-37-23-27)21-26(34)7-8-29-31-10-9-30(25-5-3-17-36-22-25)35(31,2)16-12-32(29)34/h3-7,9,17-18,22-24,28-29,31-32H,8,10-16,19-21H2,1-2H3/t28?,29?,31-,32-,34?,35?/m0/s1 |
| InChIKey | KIVAHBUMQAVYIL-AVAFSVLTSA-N |
| XLogP | 7.26 |
| TPSA | 55.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.75 |
| LogP ≤ 5 | 7.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|