C30H40N2O2 — CID 145087943
[(3S,8R,10R,13S,14R)-10,13-dimethyl-17-pyridin-3-yl-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-3-yl] 1-methylpyrrolidine-3-carboxylate (PubChem CID 145087943) has the molecular formula C30H40N2O2 and a molecular weight of 460.66 g/mol. Its IUPAC name is [(3S,8R,10R,13S,14R)-10,13-dimethyl-17-pyridin-3-yl-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-3-yl] 1-methylpyrrolidine-3-carboxylate.
| Compound Name | [(3S,8R,10R,13S,14R)-10,13-dimethyl-17-pyridin-3-yl-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-3-yl] 1-methylpyrrolidine-3-carboxylate |
|---|---|
| PubChem CID | 145087943 |
| Molecular Formula | C30H40N2O2 |
| Molecular Weight | 460.66 g/mol |
| Exact Mass | 460.31 |
| IUPAC Name | [(3S,8R,10R,13S,14R)-10,13-dimethyl-17-pyridin-3-yl-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-3-yl] 1-methylpyrrolidine-3-carboxylate |
| SMILES | CN1CCC(C(=O)O[C@H]2CC[C@@]3(C)C(=CC[C@@H]4C3CC[C@]3(C)C(c5cccnc5)=CC[C@H]43)C2)C1 |
| InChI | InChI=1S/C30H40N2O2/c1-29-13-10-23(34-28(33)21-12-16-32(3)19-21)17-22(29)6-7-24-26-9-8-25(20-5-4-15-31-18-20)30(26,2)14-11-27(24)29/h4-6,8,15,18,21,23-24,26-27H,7,9-14,16-17,19H2,1-3H3/t21?,23-,24-,26+,27?,29-,30+/m0/s1 |
| InChIKey | DATGTXSFFLZPNZ-MEJLWWRBSA-N |
| XLogP | 5.90 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.66 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|