C34H46N2O4 — CID 121368668
1-O-tert-butyl 3-O-[(3S,8R,10R,13S)-10,13-dimethyl-17-pyridin-3-yl-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-3-yl] (3S)-pyrrolidine-1,3-dicarboxylate (PubChem CID 121368668) has the molecular formula C34H46N2O4 and a molecular weight of 546.75 g/mol. Its IUPAC name is 1-O-tert-butyl 3-O-[(3S,8R,10R,13S)-10,13-dimethyl-17-pyridin-3-yl-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-3-yl] (3S)-pyrrolidine-1,3-dicarboxylate.
| Compound Name | 1-O-tert-butyl 3-O-[(3S,8R,10R,13S)-10,13-dimethyl-17-pyridin-3-yl-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-3-yl] (3S)-pyrrolidine-1,3-dicarboxylate |
|---|---|
| PubChem CID | 121368668 |
| Molecular Formula | C34H46N2O4 |
| Molecular Weight | 546.75 g/mol |
| Exact Mass | 546.35 |
| IUPAC Name | 1-O-tert-butyl 3-O-[(3S,8R,10R,13S)-10,13-dimethyl-17-pyridin-3-yl-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-3-yl] (3S)-pyrrolidine-1,3-dicarboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC[C@H](C(=O)O[C@H]2CC[C@@]3(C)C(=CC[C@@H]4C3CC[C@]3(C)C(c5cccnc5)=CCC43)C2)C1 |
| InChI | InChI=1S/C34H46N2O4/c1-32(2,3)40-31(38)36-18-14-23(21-36)30(37)39-25-12-15-33(4)24(19-25)8-9-26-28-11-10-27(22-7-6-17-35-20-22)34(28,5)16-13-29(26)33/h6-8,10,17,20,23,25-26,28-29H,9,11-16,18-19,21H2,1-5H3/t23-,25-,26-,28?,29?,33-,34+/m0/s1 |
| InChIKey | UOVMFBDJRWYYTP-WVIOLGFJSA-N |
| XLogP | 7.21 |
| TPSA | 68.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.75 |
| LogP ≤ 5 | 7.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|