C34H46N2O2 — CID 174790214
1-(cyclopropylmethyl)-2-[(3S,8R,9S,10R,13S,14S)-10,13-dimethyl-17-pyridin-3-yl-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-3-yl]piperidine-4-carboxylic acid (PubChem CID 174790214) has the molecular formula C34H46N2O2 and a molecular weight of 514.75 g/mol. Its IUPAC name is 1-(cyclopropylmethyl)-2-[(3S,8R,9S,10R,13S,14S)-10,13-dimethyl-17-pyridin-3-yl-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-3-yl]piperidine-4-carboxylic acid.
| Compound Name | 1-(cyclopropylmethyl)-2-[(3S,8R,9S,10R,13S,14S)-10,13-dimethyl-17-pyridin-3-yl-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-3-yl]piperidine-4-carboxylic acid |
|---|---|
| PubChem CID | 174790214 |
| Molecular Formula | C34H46N2O2 |
| Molecular Weight | 514.75 g/mol |
| Exact Mass | 514.36 |
| IUPAC Name | 1-(cyclopropylmethyl)-2-[(3S,8R,9S,10R,13S,14S)-10,13-dimethyl-17-pyridin-3-yl-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-3-yl]piperidine-4-carboxylic acid |
| SMILES | C[C@]12CC[C@H](C3CC(C(=O)O)CCN3CC3CC3)CC1=CC[C@@H]1[C@@H]2CC[C@]2(C)C(c3cccnc3)=CC[C@@H]12 |
| InChI | InChI=1S/C34H46N2O2/c1-33-14-11-23(31-19-24(32(37)38)13-17-36(31)21-22-5-6-22)18-26(33)7-8-27-29-10-9-28(25-4-3-16-35-20-25)34(29,2)15-12-30(27)33/h3-4,7,9,16,20,22-24,27,29-31H,5-6,8,10-15,17-19,21H2,1-2H3,(H,37,38)/t23-,24?,27-,29-,30-,31?,33-,34+/m0/s1 |
| InChIKey | GMLBMJNPRBFHEW-WULLVQLLSA-N |
| XLogP | 7.23 |
| TPSA | 53.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.75 |
| LogP ≤ 5 | 7.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|