C31H45N3O2 — CID 174344096
[1-[(8S,9S,10R,13S,14S)-10,13-dimethyl-17-pyridin-3-yl-2,3,6,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-3-yl]propylamino] 3-(methylamino)propanoate (PubChem CID 174344096) has the molecular formula C31H45N3O2 and a molecular weight of 491.72 g/mol. Its IUPAC name is [1-[(8S,9S,10R,13S,14S)-10,13-dimethyl-17-pyridin-3-yl-2,3,6,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-3-yl]propylamino] 3-(methylamino)propanoate.
| Compound Name | [1-[(8S,9S,10R,13S,14S)-10,13-dimethyl-17-pyridin-3-yl-2,3,6,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-3-yl]propylamino] 3-(methylamino)propanoate |
|---|---|
| PubChem CID | 174344096 |
| Molecular Formula | C31H45N3O2 |
| Molecular Weight | 491.72 g/mol |
| Exact Mass | 491.35 |
| IUPAC Name | [1-[(8S,9S,10R,13S,14S)-10,13-dimethyl-17-pyridin-3-yl-2,3,6,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-3-yl]propylamino] 3-(methylamino)propanoate |
| SMILES | CCC(NOC(=O)CCNC)C1C=C2CC[C@H]3[C@H](CC[C@]4(C)C(c5cccnc5)=CC[C@@H]34)[C@@]2(C)CC1 |
| InChI | InChI=1S/C31H45N3O2/c1-5-28(34-36-29(35)14-18-32-4)21-12-15-30(2)23(19-21)8-9-24-26-11-10-25(22-7-6-17-33-20-22)31(26,3)16-13-27(24)30/h6-7,10,17,19-21,24,26-28,32,34H,5,8-9,11-16,18H2,1-4H3/t21?,24-,26+,27+,28?,30+,31-/m1/s1 |
| InChIKey | IKWKJKIYWMJPCO-XQURJYQKSA-N |
| XLogP | 6.09 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.72 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|