C31H40N2O5 — CID 144987341
2-[[4-[[(3S,8R,10R,13S)-10,13-dimethyl-17-pyridin-3-yl-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-3-yl]oxy]-4-oxobutanoyl]amino]propanoic acid (PubChem CID 144987341) has the molecular formula C31H40N2O5 and a molecular weight of 520.67 g/mol. Its IUPAC name is 2-[[4-[[(3S,8R,10R,13S)-10,13-dimethyl-17-pyridin-3-yl-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-3-yl]oxy]-4-oxobutanoyl]amino]propanoic acid.
| Compound Name | 2-[[4-[[(3S,8R,10R,13S)-10,13-dimethyl-17-pyridin-3-yl-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-3-yl]oxy]-4-oxobutanoyl]amino]propanoic acid |
|---|---|
| PubChem CID | 144987341 |
| Molecular Formula | C31H40N2O5 |
| Molecular Weight | 520.67 g/mol |
| Exact Mass | 520.29 |
| IUPAC Name | 2-[[4-[[(3S,8R,10R,13S)-10,13-dimethyl-17-pyridin-3-yl-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-3-yl]oxy]-4-oxobutanoyl]amino]propanoic acid |
| SMILES | CC(NC(=O)CCC(=O)O[C@H]1CC[C@@]2(C)C(=CC[C@@H]3C2CC[C@]2(C)C(c4cccnc4)=CCC32)C1)C(=O)O |
| InChI | InChI=1S/C31H40N2O5/c1-19(29(36)37)33-27(34)10-11-28(35)38-22-12-14-30(2)21(17-22)6-7-23-25-9-8-24(20-5-4-16-32-18-20)31(25,3)15-13-26(23)30/h4-6,8,16,18-19,22-23,25-26H,7,9-15,17H2,1-3H3,(H,33,34)(H,36,37)/t19?,22-,23-,25?,26?,30-,31+/m0/s1 |
| InChIKey | LDSREVWXWIPGED-AWZVACFCSA-N |
| XLogP | 5.32 |
| TPSA | 105.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.67 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|