C32H44N4O3 — CID 174343651
[[(8S,9S,10R,13S,14S)-10,13-dimethyl-17-pyridin-3-yl-1,2,6,7,8,9,11,12,14,15-decahydrocyclopenta[a]phenanthren-3-ylidene]amino] 4-[2-(dimethylamino)ethylamino]-4-oxobutanoate (PubChem CID 174343651) has the molecular formula C32H44N4O3 and a molecular weight of 532.73 g/mol. Its IUPAC name is [[(8S,9S,10R,13S,14S)-10,13-dimethyl-17-pyridin-3-yl-1,2,6,7,8,9,11,12,14,15-decahydrocyclopenta[a]phenanthren-3-ylidene]amino] 4-[2-(dimethylamino)ethylamino]-4-oxobutanoate.
| Compound Name | [[(8S,9S,10R,13S,14S)-10,13-dimethyl-17-pyridin-3-yl-1,2,6,7,8,9,11,12,14,15-decahydrocyclopenta[a]phenanthren-3-ylidene]amino] 4-[2-(dimethylamino)ethylamino]-4-oxobutanoate |
|---|---|
| PubChem CID | 174343651 |
| Molecular Formula | C32H44N4O3 |
| Molecular Weight | 532.73 g/mol |
| Exact Mass | 532.34 |
| IUPAC Name | [[(8S,9S,10R,13S,14S)-10,13-dimethyl-17-pyridin-3-yl-1,2,6,7,8,9,11,12,14,15-decahydrocyclopenta[a]phenanthren-3-ylidene]amino] 4-[2-(dimethylamino)ethylamino]-4-oxobutanoate |
| SMILES | CN(C)CCNC(=O)CCC(=O)ON=C1C=C2CC[C@H]3[C@H](CC[C@]4(C)C(c5cccnc5)=CC[C@@H]34)[C@@]2(C)CC1 |
| InChI | InChI=1S/C32H44N4O3/c1-31-15-13-24(35-39-30(38)12-11-29(37)34-18-19-36(3)4)20-23(31)7-8-25-27-10-9-26(22-6-5-17-33-21-22)32(27,2)16-14-28(25)31/h5-6,9,17,20-21,25,27-28H,7-8,10-16,18-19H2,1-4H3,(H,34,37)/t25-,27+,28+,31+,32-/m1/s1 |
| InChIKey | PAPAHGATXVFCIG-UTMGYQFDSA-N |
| XLogP | 5.39 |
| TPSA | 83.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.73 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|