C25H20Br2F6N4O3S2 — CID 162173340
2-[[4-(4-bromophenyl)-1,3-thiazol-2-yl]amino]-3,3,3-trifluoropropan-1-ol;methyl (2R)-2-[[4-(4-bromophenyl)-1,3-thiazol-2-yl]amino]-3,3,3-trifluoropropanoate (PubChem CID 162173340) has the molecular formula C25H20Br2F6N4O3S2 and a molecular weight of 762.39 g/mol. Its IUPAC name is 2-[[4-(4-bromophenyl)-1,3-thiazol-2-yl]amino]-3,3,3-trifluoropropan-1-ol;methyl (2R)-2-[[4-(4-bromophenyl)-1,3-thiazol-2-yl]amino]-3,3,3-trifluoropropanoate.
| Compound Name | 2-[[4-(4-bromophenyl)-1,3-thiazol-2-yl]amino]-3,3,3-trifluoropropan-1-ol;methyl (2R)-2-[[4-(4-bromophenyl)-1,3-thiazol-2-yl]amino]-3,3,3-trifluoropropanoate |
|---|---|
| PubChem CID | 162173340 |
| Molecular Formula | C25H20Br2F6N4O3S2 |
| Molecular Weight | 762.39 g/mol |
| Exact Mass | 759.92 |
| IUPAC Name | 2-[[4-(4-bromophenyl)-1,3-thiazol-2-yl]amino]-3,3,3-trifluoropropan-1-ol;methyl (2R)-2-[[4-(4-bromophenyl)-1,3-thiazol-2-yl]amino]-3,3,3-trifluoropropanoate |
| SMILES | COC(=O)[C@@H](Nc1nc(-c2ccc(Br)cc2)cs1)C(F)(F)F.OCC(Nc1nc(-c2ccc(Br)cc2)cs1)C(F)(F)F |
| InChI | InChI=1S/C13H10BrF3N2O2S.C12H10BrF3N2OS/c1-21-11(20)10(13(15,16)17)19-12-18-9(6-22-12)7-2-4-8(14)5-3-7;13-8-3-1-7(2-4-8)9-6-20-11(17-9)18-10(5-19)12(14,15)16/h2-6,10H,1H3,(H,18,19);1-4,6,10,19H,5H2,(H,17,18)/t10-;/m1./s1 |
| InChIKey | ZOBMSXRMVFOLOS-HNCPQSOCSA-N |
| XLogP | 8.00 |
| TPSA | 96.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 762.39 |
| LogP ≤ 5 | 8.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |