C19H22N4O5 — CID 162173561
(E)-but-2-enedioic acid;4-[6-(furan-2-yl)pyridazin-3-yl]-1,4-diazabicyclo[3.2.2]nonane (PubChem CID 162173561) has the molecular formula C19H22N4O5 and a molecular weight of 386.41 g/mol. Its IUPAC name is (E)-but-2-enedioic acid;4-[6-(furan-2-yl)pyridazin-3-yl]-1,4-diazabicyclo[3.2.2]nonane.
| Compound Name | (E)-but-2-enedioic acid;4-[6-(furan-2-yl)pyridazin-3-yl]-1,4-diazabicyclo[3.2.2]nonane |
|---|---|
| PubChem CID | 162173561 |
| Molecular Formula | C19H22N4O5 |
| Molecular Weight | 386.41 g/mol |
| Exact Mass | 386.16 |
| IUPAC Name | (E)-but-2-enedioic acid;4-[6-(furan-2-yl)pyridazin-3-yl]-1,4-diazabicyclo[3.2.2]nonane |
| SMILES | O=C(O)/C=C/C(=O)O.c1coc(-c2ccc(N3CCN4CCC3CC4)nn2)c1 |
| InChI | InChI=1S/C15H18N4O.C4H4O4/c1-2-14(20-11-1)13-3-4-15(17-16-13)19-10-9-18-7-5-12(19)6-8-18;5-3(6)1-2-4(7)8/h1-4,11-12H,5-10H2;1-2H,(H,5,6)(H,7,8)/b;2-1+ |
| InChIKey | ZOCHBGBQVNNKGC-WLHGVMLRSA-N |
| XLogP | 1.73 |
| TPSA | 120.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.41 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|