C17H20N4O6 — CID 161249063
(E)-but-2-enedioic acid;2-(1,4-diazabicyclo[3.2.2]nonan-4-yl)-5-(furan-2-yl)-1,3,4-oxadiazole (PubChem CID 161249063) has the molecular formula C17H20N4O6 and a molecular weight of 376.37 g/mol. Its IUPAC name is (E)-but-2-enedioic acid;2-(1,4-diazabicyclo[3.2.2]nonan-4-yl)-5-(furan-2-yl)-1,3,4-oxadiazole.
| Compound Name | (E)-but-2-enedioic acid;2-(1,4-diazabicyclo[3.2.2]nonan-4-yl)-5-(furan-2-yl)-1,3,4-oxadiazole |
|---|---|
| PubChem CID | 161249063 |
| Molecular Formula | C17H20N4O6 |
| Molecular Weight | 376.37 g/mol |
| Exact Mass | 376.14 |
| IUPAC Name | (E)-but-2-enedioic acid;2-(1,4-diazabicyclo[3.2.2]nonan-4-yl)-5-(furan-2-yl)-1,3,4-oxadiazole |
| SMILES | O=C(O)/C=C/C(=O)O.c1coc(-c2nnc(N3CCN4CCC3CC4)o2)c1 |
| InChI | InChI=1S/C13H16N4O2.C4H4O4/c1-2-11(18-9-1)12-14-15-13(19-12)17-8-7-16-5-3-10(17)4-6-16;5-3(6)1-2-4(7)8/h1-2,9-10H,3-8H2;1-2H,(H,5,6)(H,7,8)/b;2-1+ |
| InChIKey | VBAIEOYHSKGWDH-WLHGVMLRSA-N |
| XLogP | 1.33 |
| TPSA | 133.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.37 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|