C38H41O11P — CID 162178335
[2-[2-[4-(diethoxyphosphoryloxymethyl)phenyl]acetyl]phenyl] acetate;[2-[2-[4-(hydroxymethyl)phenyl]acetyl]phenyl] acetate (PubChem CID 162178335) has the molecular formula C38H41O11P and a molecular weight of 704.71 g/mol. Its IUPAC name is [2-[2-[4-(diethoxyphosphoryloxymethyl)phenyl]acetyl]phenyl] acetate;[2-[2-[4-(hydroxymethyl)phenyl]acetyl]phenyl] acetate.
| Compound Name | [2-[2-[4-(diethoxyphosphoryloxymethyl)phenyl]acetyl]phenyl] acetate;[2-[2-[4-(hydroxymethyl)phenyl]acetyl]phenyl] acetate |
|---|---|
| PubChem CID | 162178335 |
| Molecular Formula | C38H41O11P |
| Molecular Weight | 704.71 g/mol |
| Exact Mass | 704.24 |
| IUPAC Name | [2-[2-[4-(diethoxyphosphoryloxymethyl)phenyl]acetyl]phenyl] acetate;[2-[2-[4-(hydroxymethyl)phenyl]acetyl]phenyl] acetate |
| SMILES | CC(=O)Oc1ccccc1C(=O)Cc1ccc(CO)cc1.CCOP(=O)(OCC)OCc1ccc(CC(=O)c2ccccc2OC(C)=O)cc1 |
| InChI | InChI=1S/C21H25O7P.C17H16O4/c1-4-25-29(24,26-5-2)27-15-18-12-10-17(11-13-18)14-20(23)19-8-6-7-9-21(19)28-16(3)22;1-12(19)21-17-5-3-2-4-15(17)16(20)10-13-6-8-14(11-18)9-7-13/h6-13H,4-5,14-15H2,1-3H3;2-9,18H,10-11H2,1H3 |
| InChIKey | ZORNOFVEWTYCCV-UHFFFAOYSA-N |
| XLogP | 7.26 |
| TPSA | 151.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 50 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 704.71 |
| LogP ≤ 5 | 7.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|