C33H40N2O4 — CID 162182204
3-[(E)-4-[4-(1-adamantyl)phenoxy]-2-oxobut-3-enyl]-N-(2-morpholin-4-ylethyl)benzamide (PubChem CID 162182204) has the molecular formula C33H40N2O4 and a molecular weight of 528.69 g/mol. Its IUPAC name is 3-[(E)-4-[4-(1-adamantyl)phenoxy]-2-oxobut-3-enyl]-N-(2-morpholin-4-ylethyl)benzamide.
| Compound Name | 3-[(E)-4-[4-(1-adamantyl)phenoxy]-2-oxobut-3-enyl]-N-(2-morpholin-4-ylethyl)benzamide |
|---|---|
| PubChem CID | 162182204 |
| Molecular Formula | C33H40N2O4 |
| Molecular Weight | 528.69 g/mol |
| Exact Mass | 528.30 |
| IUPAC Name | 3-[(E)-4-[4-(1-adamantyl)phenoxy]-2-oxobut-3-enyl]-N-(2-morpholin-4-ylethyl)benzamide |
| SMILES | O=C(/C=C/Oc1ccc(C23CC4CC(CC(C4)C2)C3)cc1)Cc1cccc(C(=O)NCCN2CCOCC2)c1 |
| InChI | InChI=1S/C33H40N2O4/c36-30(20-24-2-1-3-28(19-24)32(37)34-9-10-35-11-14-38-15-12-35)8-13-39-31-6-4-29(5-7-31)33-21-25-16-26(22-33)18-27(17-25)23-33/h1-8,13,19,25-27H,9-12,14-18,20-23H2,(H,34,37)/b13-8+ |
| InChIKey | ZPEIKWJUWJHCAV-MDWZMJQESA-N |
| XLogP | 4.92 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.69 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|