C37H40Cl2N6O3 — CID 162183282
(2S,5R)-5-amino-N-[(2R)-1-amino-3-[4-(4-chlorophenyl)phenyl]-1-oxopropan-2-yl]-6-[4-(4-chlorophenyl)phenyl]-2-[3-(diaminomethylideneamino)propyl]-4-oxohexanamide (PubChem CID 162183282) has the molecular formula C37H40Cl2N6O3 and a molecular weight of 687.67 g/mol. Its IUPAC name is (2S,5R)-5-amino-N-[(2R)-1-amino-3-[4-(4-chlorophenyl)phenyl]-1-oxopropan-2-yl]-6-[4-(4-chlorophenyl)phenyl]-2-[3-(diaminomethylideneamino)propyl]-4-oxohexanamide.
| Compound Name | (2S,5R)-5-amino-N-[(2R)-1-amino-3-[4-(4-chlorophenyl)phenyl]-1-oxopropan-2-yl]-6-[4-(4-chlorophenyl)phenyl]-2-[3-(diaminomethylideneamino)propyl]-4-oxohexanamide |
|---|---|
| PubChem CID | 162183282 |
| Molecular Formula | C37H40Cl2N6O3 |
| Molecular Weight | 687.67 g/mol |
| Exact Mass | 686.25 |
| IUPAC Name | (2S,5R)-5-amino-N-[(2R)-1-amino-3-[4-(4-chlorophenyl)phenyl]-1-oxopropan-2-yl]-6-[4-(4-chlorophenyl)phenyl]-2-[3-(diaminomethylideneamino)propyl]-4-oxohexanamide |
| SMILES | NC(=O)[C@@H](Cc1ccc(-c2ccc(Cl)cc2)cc1)NC(=O)C(CCCN=C(N)N)CC(=O)[C@H](N)Cc1ccc(-c2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C37H40Cl2N6O3/c38-30-15-11-27(12-16-30)25-7-3-23(4-8-25)20-32(40)34(46)22-29(2-1-19-44-37(42)43)36(48)45-33(35(41)47)21-24-5-9-26(10-6-24)28-13-17-31(39)18-14-28/h3-18,29,32-33H,1-2,19-22,40H2,(H2,41,47)(H,45,48)(H4,42,43,44)/t29?,32-,33-/m1/s1 |
| InChIKey | ZPICHSUDOCQRTK-ZPACHCIOSA-N |
| XLogP | 5.04 |
| TPSA | 179.68 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 687.67 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|