C43H56N8O2 — CID 146838374
2-[(4R,7S)-7-amino-4-[[[(2S)-8-(diaminomethylideneamino)-3-oxo-1-(4-phenylphenyl)octan-2-yl]amino]methyl]-6-oxo-8-(4-phenylphenyl)octyl]guanidine (PubChem CID 146838374) has the molecular formula C43H56N8O2 and a molecular weight of 716.98 g/mol. Its IUPAC name is 2-[(4R,7S)-7-amino-4-[[[(2S)-8-(diaminomethylideneamino)-3-oxo-1-(4-phenylphenyl)octan-2-yl]amino]methyl]-6-oxo-8-(4-phenylphenyl)octyl]guanidine.
| Compound Name | 2-[(4R,7S)-7-amino-4-[[[(2S)-8-(diaminomethylideneamino)-3-oxo-1-(4-phenylphenyl)octan-2-yl]amino]methyl]-6-oxo-8-(4-phenylphenyl)octyl]guanidine |
|---|---|
| PubChem CID | 146838374 |
| Molecular Formula | C43H56N8O2 |
| Molecular Weight | 716.98 g/mol |
| Exact Mass | 716.45 |
| IUPAC Name | 2-[(4R,7S)-7-amino-4-[[[(2S)-8-(diaminomethylideneamino)-3-oxo-1-(4-phenylphenyl)octan-2-yl]amino]methyl]-6-oxo-8-(4-phenylphenyl)octyl]guanidine |
| SMILES | NC(N)=NCCCCCC(=O)[C@H](Cc1ccc(-c2ccccc2)cc1)NC[C@H](CCCN=C(N)N)CC(=O)[C@@H](N)Cc1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C43H56N8O2/c44-38(27-31-17-21-36(22-18-31)34-12-4-1-5-13-34)41(53)29-33(11-10-26-50-43(47)48)30-51-39(40(52)16-8-3-9-25-49-42(45)46)28-32-19-23-37(24-20-32)35-14-6-2-7-15-35/h1-2,4-7,12-15,17-24,33,38-39,51H,3,8-11,16,25-30,44H2,(H4,45,46,49)(H4,47,48,50)/t33-,38+,39+/m1/s1 |
| InChIKey | SFODQTQPFRCGEL-IUNOAQLMSA-N |
| XLogP | 5.12 |
| TPSA | 200.99 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 53 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 716.98 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|