C20H30ClN5O3 — CID 87992105
2-[(4S)-4-[[(5R)-5-amino-4-oxo-6-phenylhexyl]amino]-7-chloro-5,6-dioxoheptyl]guanidine (PubChem CID 87992105) has the molecular formula C20H30ClN5O3 and a molecular weight of 423.95 g/mol. Its IUPAC name is 2-[(4S)-4-[[(5R)-5-amino-4-oxo-6-phenylhexyl]amino]-7-chloro-5,6-dioxoheptyl]guanidine.
| Compound Name | 2-[(4S)-4-[[(5R)-5-amino-4-oxo-6-phenylhexyl]amino]-7-chloro-5,6-dioxoheptyl]guanidine |
|---|---|
| PubChem CID | 87992105 |
| Molecular Formula | C20H30ClN5O3 |
| Molecular Weight | 423.95 g/mol |
| Exact Mass | 423.20 |
| IUPAC Name | 2-[(4S)-4-[[(5R)-5-amino-4-oxo-6-phenylhexyl]amino]-7-chloro-5,6-dioxoheptyl]guanidine |
| SMILES | NC(N)=NCCC[C@H](NCCCC(=O)[C@H](N)Cc1ccccc1)C(=O)C(=O)CCl |
| InChI | InChI=1S/C20H30ClN5O3/c21-13-18(28)19(29)16(8-4-11-26-20(23)24)25-10-5-9-17(27)15(22)12-14-6-2-1-3-7-14/h1-3,6-7,15-16,25H,4-5,8-13,22H2,(H4,23,24,26)/t15-,16+/m1/s1 |
| InChIKey | TWYKFVSQXHCFQS-CVEARBPZSA-N |
| XLogP | 0.29 |
| TPSA | 153.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.95 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|