C27H38O5 — CID 162183767
3-ethyl-3-[[1-[(3-ethyloxetan-3-yl)methoxy]-4-phenylcyclohexa-2,4-dien-1-yl]oxymethyl]oxetane;oxetane (PubChem CID 162183767) has the molecular formula C27H38O5 and a molecular weight of 442.60 g/mol. Its IUPAC name is 3-ethyl-3-[[1-[(3-ethyloxetan-3-yl)methoxy]-4-phenylcyclohexa-2,4-dien-1-yl]oxymethyl]oxetane;oxetane.
| Compound Name | 3-ethyl-3-[[1-[(3-ethyloxetan-3-yl)methoxy]-4-phenylcyclohexa-2,4-dien-1-yl]oxymethyl]oxetane;oxetane |
|---|---|
| PubChem CID | 162183767 |
| Molecular Formula | C27H38O5 |
| Molecular Weight | 442.60 g/mol |
| Exact Mass | 442.27 |
| IUPAC Name | 3-ethyl-3-[[1-[(3-ethyloxetan-3-yl)methoxy]-4-phenylcyclohexa-2,4-dien-1-yl]oxymethyl]oxetane;oxetane |
| SMILES | C1COC1.CCC1(COC2(OCC3(CC)COC3)C=CC(c3ccccc3)=CC2)COC1 |
| InChI | InChI=1S/C24H32O4.C3H6O/c1-3-22(14-25-15-22)18-27-24(28-19-23(4-2)16-26-17-23)12-10-21(11-13-24)20-8-6-5-7-9-20;1-2-4-3-1/h5-12H,3-4,13-19H2,1-2H3;1-3H2 |
| InChIKey | ZPJSWWJHNZSCFC-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.60 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|