About fluoromethyl-(4-methylphenyl)-phenylsulfanium;2-methylpropane;tetrafluoroborate
fluoromethyl-(4-methylphenyl)-phenylsulfanium;2-methylpropane;tetrafluoroborate (PubChem CID 162185007) has the molecular formula C18H24BF5S
and a molecular weight of 378.26 g/mol. Its IUPAC name is fluoromethyl-(4-methylphenyl)-phenylsulfanium;2-methylpropane;tetrafluoroborate.
Molecular Properties
| Compound Name | fluoromethyl-(4-methylphenyl)-phenylsulfanium;2-methylpropane;tetrafluoroborate |
| PubChem CID | 162185007 |
| Molecular Formula | C18H24BF5S |
| Molecular Weight | 378.26 g/mol |
| Exact Mass | 378.16 |
| IUPAC Name | fluoromethyl-(4-methylphenyl)-phenylsulfanium;2-methylpropane;tetrafluoroborate |
| SMILES | CC(C)C.Cc1ccc([S+](CF)c2ccccc2)cc1.F[B-](F)(F)F |
| InChI | InChI=1S/C14H14FS.C4H10.BF4/c1-12-7-9-14(10-8-12)16(11-15)13-5-3-2-4-6-13;1-4(2)3;2-1(3,4)5/h2-10H,11H2,1H3;4H,1-3H3;/q+1;;-1 |
| InChIKey | ZPNUBMKUCLLPFZ-UHFFFAOYSA-N |
| XLogP | 6.92 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 378.26 |
| LogP ≤ 5 | 6.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze fluoromethyl-(4-methylphenyl)-phenylsulfanium;2-methylpropane;tetrafluoroborate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of fluoromethyl-(4-methylphenyl)-phenylsulfanium;2-methylpropane;tetrafluoroborate?
The IUPAC name of fluoromethyl-(4-methylphenyl)-phenylsulfanium;2-methylpropane;tetrafluoroborate (CID 162185007) is fluoromethyl-(4-methylphenyl)-phenylsulfanium;2-methylpropane;tetrafluoroborate.
What is the SMILES notation for fluoromethyl-(4-methylphenyl)-phenylsulfanium;2-methylpropane;tetrafluoroborate?
The canonical SMILES for fluoromethyl-(4-methylphenyl)-phenylsulfanium;2-methylpropane;tetrafluoroborate is CC(C)C.Cc1ccc([S+](CF)c2ccccc2)cc1.F[B-](F)(F)F.
What is the InChIKey of fluoromethyl-(4-methylphenyl)-phenylsulfanium;2-methylpropane;tetrafluoroborate?
The InChIKey is ZPNUBMKUCLLPFZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H14FS.C4H10.BF4/c1-12-7-9-14(10-8-12)16(11-15)13-5-3-2-4-6-13;1-4(2)3;2-1(3,4)5/h2-10H,11H2,1H3;4H,1-3H3;/q+1;;-1.
What are the key properties of fluoromethyl-(4-methylphenyl)-phenylsulfanium;2-methylpropane;tetrafluoroborate?
fluoromethyl-(4-methylphenyl)-phenylsulfanium;2-methylpropane;tetrafluoroborate has a molecular weight of 378.26 g/mol, XLogP of 6.92, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for fluoromethyl-(4-methylphenyl)-phenylsulfanium;2-methylpropane;tetrafluoroborate is sourced from PubChem (CID 162185007), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).