About (Z)-4-amino-4-oxobut-2-enoic acid;2-hydroperoxy-2-methylpropane
(Z)-4-amino-4-oxobut-2-enoic acid;2-hydroperoxy-2-methylpropane (PubChem CID 162190186) has the molecular formula C8H15NO5
and a molecular weight of 205.21 g/mol. Its IUPAC name is (Z)-4-amino-4-oxobut-2-enoic acid;2-hydroperoxy-2-methylpropane.
Molecular Properties
| Compound Name | (Z)-4-amino-4-oxobut-2-enoic acid;2-hydroperoxy-2-methylpropane |
| PubChem CID | 162190186 |
| Molecular Formula | C8H15NO5 |
| Molecular Weight | 205.21 g/mol |
| Exact Mass | 205.10 |
| IUPAC Name | (Z)-4-amino-4-oxobut-2-enoic acid;2-hydroperoxy-2-methylpropane |
| SMILES | CC(C)(C)OO.NC(=O)/C=C\C(=O)O |
| InChI | InChI=1S/C4H5NO3.C4H10O2/c5-3(6)1-2-4(7)8;1-4(2,3)6-5/h1-2H,(H2,5,6)(H,7,8);5H,1-3H3/b2-1-; |
| InChIKey | ZQEQZYBTNBDCBC-ODZAUARKSA-N |
| XLogP | 0.39 |
| TPSA | 109.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 205.21 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze (Z)-4-amino-4-oxobut-2-enoic acid;2-hydroperoxy-2-methylpropane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-4-amino-4-oxobut-2-enoic acid;2-hydroperoxy-2-methylpropane?
The IUPAC name of (Z)-4-amino-4-oxobut-2-enoic acid;2-hydroperoxy-2-methylpropane (CID 162190186) is (Z)-4-amino-4-oxobut-2-enoic acid;2-hydroperoxy-2-methylpropane.
What is the SMILES notation for (Z)-4-amino-4-oxobut-2-enoic acid;2-hydroperoxy-2-methylpropane?
The canonical SMILES for (Z)-4-amino-4-oxobut-2-enoic acid;2-hydroperoxy-2-methylpropane is CC(C)(C)OO.NC(=O)/C=C\C(=O)O.
What is the InChIKey of (Z)-4-amino-4-oxobut-2-enoic acid;2-hydroperoxy-2-methylpropane?
The InChIKey is ZQEQZYBTNBDCBC-ODZAUARKSA-N. The full InChI is InChI=1S/C4H5NO3.C4H10O2/c5-3(6)1-2-4(7)8;1-4(2,3)6-5/h1-2H,(H2,5,6)(H,7,8);5H,1-3H3/b2-1-;.
What are the key properties of (Z)-4-amino-4-oxobut-2-enoic acid;2-hydroperoxy-2-methylpropane?
(Z)-4-amino-4-oxobut-2-enoic acid;2-hydroperoxy-2-methylpropane has a molecular weight of 205.21 g/mol, XLogP of 0.39, 2 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-4-amino-4-oxobut-2-enoic acid;2-hydroperoxy-2-methylpropane is sourced from PubChem (CID 162190186), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).