C20H22BBrN4O2 — CID 162193658
5-bromo-1H-indazole;5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-indazole (PubChem CID 162193658) has the molecular formula C20H22BBrN4O2 and a molecular weight of 441.14 g/mol. Its IUPAC name is 5-bromo-1H-indazole;5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-indazole.
| Compound Name | 5-bromo-1H-indazole;5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-indazole |
|---|---|
| PubChem CID | 162193658 |
| Molecular Formula | C20H22BBrN4O2 |
| Molecular Weight | 441.14 g/mol |
| Exact Mass | 440.10 |
| IUPAC Name | 5-bromo-1H-indazole;5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-indazole |
| SMILES | Brc1ccc2[nH]ncc2c1.CC1(C)OB(c2ccc3[nH]ncc3c2)OC1(C)C |
| InChI | InChI=1S/C13H17BN2O2.C7H5BrN2/c1-12(2)13(3,4)18-14(17-12)10-5-6-11-9(7-10)8-15-16-11;8-6-1-2-7-5(3-6)4-9-10-7/h5-8H,1-4H3,(H,15,16);1-4H,(H,9,10) |
| InChIKey | ZQQQYLLIDJRQNA-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 75.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.14 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|