C20H20FN — CID 162205198
2-cyclohexylidene-13-(18F)fluoro-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaene (PubChem CID 162205198) has the molecular formula C20H20FN and a molecular weight of 292.39 g/mol. Its IUPAC name is 2-cyclohexylidene-13-(18F)fluoro-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaene.
| Compound Name | 2-cyclohexylidene-13-(18F)fluoro-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaene |
|---|---|
| PubChem CID | 162205198 |
| Molecular Formula | C20H20FN |
| Molecular Weight | 292.39 g/mol |
| Exact Mass | 292.16 |
| IUPAC Name | 2-cyclohexylidene-13-(18F)fluoro-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaene |
| SMILES | [18F]c1ccc2c(c1)CCc1cccnc1C2=C1CCCCC1 |
| InChI | InChI=1S/C20H20FN/c21-17-10-11-18-16(13-17)9-8-15-7-4-12-22-20(15)19(18)14-5-2-1-3-6-14/h4,7,10-13H,1-3,5-6,8-9H2/i21-1 |
| InChIKey | ZSCDUGWUJZCLFE-GJQNQZCXSA-N |
| XLogP | 5.09 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.39 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |