About (3R)-1-benzyl-3-[2-(2-bromophenoxy)ethyl]piperazine;1-bromo-2-fluorobenzene
(3R)-1-benzyl-3-[2-(2-bromophenoxy)ethyl]piperazine;1-bromo-2-fluorobenzene (PubChem CID 162207339) has the molecular formula C25H27Br2FN2O
and a molecular weight of 550.31 g/mol. Its IUPAC name is (3R)-1-benzyl-3-[2-(2-bromophenoxy)ethyl]piperazine;1-bromo-2-fluorobenzene.
Molecular Properties
| Compound Name | (3R)-1-benzyl-3-[2-(2-bromophenoxy)ethyl]piperazine;1-bromo-2-fluorobenzene |
| PubChem CID | 162207339 |
| Molecular Formula | C25H27Br2FN2O |
| Molecular Weight | 550.31 g/mol |
| Exact Mass | 548.05 |
| IUPAC Name | (3R)-1-benzyl-3-[2-(2-bromophenoxy)ethyl]piperazine;1-bromo-2-fluorobenzene |
| SMILES | Brc1ccccc1OCC[C@@H]1CN(Cc2ccccc2)CCN1.Fc1ccccc1Br |
| InChI | InChI=1S/C19H23BrN2O.C6H4BrF/c20-18-8-4-5-9-19(18)23-13-10-17-15-22(12-11-21-17)14-16-6-2-1-3-7-16;7-5-3-1-2-4-6(5)8/h1-9,17,21H,10-15H2;1-4H/t17-;/m1./s1 |
| InChIKey | ZSJJGVVVSORLJH-UNTBIKODSA-N |
| XLogP | 6.28 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 550.31 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (3R)-1-benzyl-3-[2-(2-bromophenoxy)ethyl]piperazine;1-bromo-2-fluorobenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3R)-1-benzyl-3-[2-(2-bromophenoxy)ethyl]piperazine;1-bromo-2-fluorobenzene?
The IUPAC name of (3R)-1-benzyl-3-[2-(2-bromophenoxy)ethyl]piperazine;1-bromo-2-fluorobenzene (CID 162207339) is (3R)-1-benzyl-3-[2-(2-bromophenoxy)ethyl]piperazine;1-bromo-2-fluorobenzene.
What is the SMILES notation for (3R)-1-benzyl-3-[2-(2-bromophenoxy)ethyl]piperazine;1-bromo-2-fluorobenzene?
The canonical SMILES for (3R)-1-benzyl-3-[2-(2-bromophenoxy)ethyl]piperazine;1-bromo-2-fluorobenzene is Brc1ccccc1OCC[C@@H]1CN(Cc2ccccc2)CCN1.Fc1ccccc1Br.
What is the InChIKey of (3R)-1-benzyl-3-[2-(2-bromophenoxy)ethyl]piperazine;1-bromo-2-fluorobenzene?
The InChIKey is ZSJJGVVVSORLJH-UNTBIKODSA-N. The full InChI is InChI=1S/C19H23BrN2O.C6H4BrF/c20-18-8-4-5-9-19(18)23-13-10-17-15-22(12-11-21-17)14-16-6-2-1-3-7-16;7-5-3-1-2-4-6(5)8/h1-9,17,21H,10-15H2;1-4H/t17-;/m1./s1.
What are the key properties of (3R)-1-benzyl-3-[2-(2-bromophenoxy)ethyl]piperazine;1-bromo-2-fluorobenzene?
(3R)-1-benzyl-3-[2-(2-bromophenoxy)ethyl]piperazine;1-bromo-2-fluorobenzene has a molecular weight of 550.31 g/mol, XLogP of 6.28, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3R)-1-benzyl-3-[2-(2-bromophenoxy)ethyl]piperazine;1-bromo-2-fluorobenzene is sourced from PubChem (CID 162207339), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).