C23H30O5 — CID 162210994
1-[3-(2-hydroxyethoxymethyl)phenyl]ethanone;1-[3-(propoxymethyl)phenyl]ethanone (PubChem CID 162210994) has the molecular formula C23H30O5 and a molecular weight of 386.49 g/mol. Its IUPAC name is 1-[3-(2-hydroxyethoxymethyl)phenyl]ethanone;1-[3-(propoxymethyl)phenyl]ethanone.
| Compound Name | 1-[3-(2-hydroxyethoxymethyl)phenyl]ethanone;1-[3-(propoxymethyl)phenyl]ethanone |
|---|---|
| PubChem CID | 162210994 |
| Molecular Formula | C23H30O5 |
| Molecular Weight | 386.49 g/mol |
| Exact Mass | 386.21 |
| IUPAC Name | 1-[3-(2-hydroxyethoxymethyl)phenyl]ethanone;1-[3-(propoxymethyl)phenyl]ethanone |
| SMILES | CC(=O)c1cccc(COCCO)c1.CCCOCc1cccc(C(C)=O)c1 |
| InChI | InChI=1S/C12H16O2.C11H14O3/c1-3-7-14-9-11-5-4-6-12(8-11)10(2)13;1-9(13)11-4-2-3-10(7-11)8-14-6-5-12/h4-6,8H,3,7,9H2,1-2H3;2-4,7,12H,5-6,8H2,1H3 |
| InChIKey | ZSVOJXSCVYIPBC-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.49 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|