C34H34BBrCl2N4O2 — CID 162211468
4-bromo-2-chloropyridine;3-(2-chloro-4-pyridinyl)-1-methylindole;1-methyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indole (PubChem CID 162211468) has the molecular formula C34H34BBrCl2N4O2 and a molecular weight of 692.29 g/mol. Its IUPAC name is 4-bromo-2-chloropyridine;3-(2-chloro-4-pyridinyl)-1-methylindole;1-methyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indole.
| Compound Name | 4-bromo-2-chloropyridine;3-(2-chloro-4-pyridinyl)-1-methylindole;1-methyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indole |
|---|---|
| PubChem CID | 162211468 |
| Molecular Formula | C34H34BBrCl2N4O2 |
| Molecular Weight | 692.29 g/mol |
| Exact Mass | 690.13 |
| IUPAC Name | 4-bromo-2-chloropyridine;3-(2-chloro-4-pyridinyl)-1-methylindole;1-methyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indole |
| SMILES | Clc1cc(Br)ccn1.Cn1cc(-c2ccnc(Cl)c2)c2ccccc21.Cn1cc(B2OC(C)(C)C(C)(C)O2)c2ccccc21 |
| InChI | InChI=1S/C15H20BNO2.C14H11ClN2.C5H3BrClN/c1-14(2)15(3,4)19-16(18-14)12-10-17(5)13-9-7-6-8-11(12)13;1-17-9-12(10-6-7-16-14(15)8-10)11-4-2-3-5-13(11)17;6-4-1-2-8-5(7)3-4/h6-10H,1-5H3;2-9H,1H3;1-3H |
| InChIKey | ZSWZMTUZJRHCNZ-UHFFFAOYSA-N |
| XLogP | 8.87 |
| TPSA | 54.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 692.29 |
| LogP ≤ 5 | 8.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|