C30H44O6 — CID 162214755
6-hydroxy-3-(3-hydroxy-3-methylpenta-1,4-dienyl)-2,4,4-trimethylcyclohex-2-en-1-one;6-hydroxy-3-(5-hydroxy-3-methylpenta-1,3-dienyl)-2,4,4-trimethylcyclohex-2-en-1-one (PubChem CID 162214755) has the molecular formula C30H44O6 and a molecular weight of 500.68 g/mol. Its IUPAC name is 6-hydroxy-3-(3-hydroxy-3-methylpenta-1,4-dienyl)-2,4,4-trimethylcyclohex-2-en-1-one;6-hydroxy-3-(5-hydroxy-3-methylpenta-1,3-dienyl)-2,4,4-trimethylcyclohex-2-en-1-one.
| Compound Name | 6-hydroxy-3-(3-hydroxy-3-methylpenta-1,4-dienyl)-2,4,4-trimethylcyclohex-2-en-1-one;6-hydroxy-3-(5-hydroxy-3-methylpenta-1,3-dienyl)-2,4,4-trimethylcyclohex-2-en-1-one |
|---|---|
| PubChem CID | 162214755 |
| Molecular Formula | C30H44O6 |
| Molecular Weight | 500.68 g/mol |
| Exact Mass | 500.31 |
| IUPAC Name | 6-hydroxy-3-(3-hydroxy-3-methylpenta-1,4-dienyl)-2,4,4-trimethylcyclohex-2-en-1-one;6-hydroxy-3-(5-hydroxy-3-methylpenta-1,3-dienyl)-2,4,4-trimethylcyclohex-2-en-1-one |
| SMILES | C=CC(C)(O)C=CC1=C(C)C(=O)C(O)CC1(C)C.CC(C=CC1=C(C)C(=O)C(O)CC1(C)C)=CCO |
| InChI | InChI=1S/2C15H22O3/c1-10(7-8-16)5-6-12-11(2)14(18)13(17)9-15(12,3)4;1-6-15(5,18)8-7-11-10(2)13(17)12(16)9-14(11,3)4/h5-7,13,16-17H,8-9H2,1-4H3;6-8,12,16,18H,1,9H2,2-5H3 |
| InChIKey | ZTHSRHQJRHOLEM-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 115.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.68 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|