C21H22Cl2FN9 — CID 162215938
10-(2-chloroethyl)-4-prop-1-ynyl-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaen-7-amine;1-(4-chloro-2-fluorophenyl)piperazine (PubChem CID 162215938) has the molecular formula C21H22Cl2FN9 and a molecular weight of 490.37 g/mol. Its IUPAC name is 10-(2-chloroethyl)-4-prop-1-ynyl-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaen-7-amine;1-(4-chloro-2-fluorophenyl)piperazine.
| Compound Name | 10-(2-chloroethyl)-4-prop-1-ynyl-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaen-7-amine;1-(4-chloro-2-fluorophenyl)piperazine |
|---|---|
| PubChem CID | 162215938 |
| Molecular Formula | C21H22Cl2FN9 |
| Molecular Weight | 490.37 g/mol |
| Exact Mass | 489.14 |
| IUPAC Name | 10-(2-chloroethyl)-4-prop-1-ynyl-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaen-7-amine;1-(4-chloro-2-fluorophenyl)piperazine |
| SMILES | CC#Cc1nc2c3cnn(CCCl)c3nc(N)n2n1.Fc1cc(Cl)ccc1N1CCNCC1 |
| InChI | InChI=1S/C11H10ClN7.C10H12ClFN2/c1-2-3-8-15-10-7-6-14-18(5-4-12)9(7)16-11(13)19(10)17-8;11-8-1-2-10(9(12)7-8)14-5-3-13-4-6-14/h6H,4-5H2,1H3,(H2,13,16);1-2,7,13H,3-6H2 |
| InChIKey | ZTLSXLXBLCKICP-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 102.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.37 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|