C25H21F4N9O4 — CID 162218060
1-(2,2-difluoroethyl)indazol-4-amine;1-(2,2-difluoroethyl)-4-nitroindazole;4-nitro-1H-indazole (PubChem CID 162218060) has the molecular formula C25H21F4N9O4 and a molecular weight of 587.49 g/mol. Its IUPAC name is 1-(2,2-difluoroethyl)indazol-4-amine;1-(2,2-difluoroethyl)-4-nitroindazole;4-nitro-1H-indazole.
| Compound Name | 1-(2,2-difluoroethyl)indazol-4-amine;1-(2,2-difluoroethyl)-4-nitroindazole;4-nitro-1H-indazole |
|---|---|
| PubChem CID | 162218060 |
| Molecular Formula | C25H21F4N9O4 |
| Molecular Weight | 587.49 g/mol |
| Exact Mass | 587.17 |
| IUPAC Name | 1-(2,2-difluoroethyl)indazol-4-amine;1-(2,2-difluoroethyl)-4-nitroindazole;4-nitro-1H-indazole |
| SMILES | Nc1cccc2c1cnn2CC(F)F.O=[N+]([O-])c1cccc2[nH]ncc12.O=[N+]([O-])c1cccc2c1cnn2CC(F)F |
| InChI | InChI=1S/C9H7F2N3O2.C9H9F2N3.C7H5N3O2/c10-9(11)5-13-7-2-1-3-8(14(15)16)6(7)4-12-13;10-9(11)5-14-8-3-1-2-7(12)6(8)4-13-14;11-10(12)7-3-1-2-6-5(7)4-8-9-6/h1-4,9H,5H2;1-4,9H,5,12H2;1-4H,(H,8,9) |
| InChIKey | ZTSXQESWORJDOJ-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 176.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.49 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|