C21H39N — CID 162223831
2,8-ditert-butyl-3,4-dihydro-1H-isoquinoline;ethane (PubChem CID 162223831) has the molecular formula C21H39N and a molecular weight of 305.55 g/mol. Its IUPAC name is 2,8-ditert-butyl-3,4-dihydro-1H-isoquinoline;ethane.
| Compound Name | 2,8-ditert-butyl-3,4-dihydro-1H-isoquinoline;ethane |
|---|---|
| PubChem CID | 162223831 |
| Molecular Formula | C21H39N |
| Molecular Weight | 305.55 g/mol |
| Exact Mass | 305.31 |
| IUPAC Name | 2,8-ditert-butyl-3,4-dihydro-1H-isoquinoline;ethane |
| SMILES | CC.CC.CC(C)(C)c1cccc2c1CN(C(C)(C)C)CC2 |
| InChI | InChI=1S/C17H27N.2C2H6/c1-16(2,3)15-9-7-8-13-10-11-18(12-14(13)15)17(4,5)6;2*1-2/h7-9H,10-12H2,1-6H3;2*1-2H3 |
| InChIKey | ZUMHTGXVFYQLHM-UHFFFAOYSA-N |
| XLogP | 6.19 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.55 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |