C31H45N7O6 — CID 162225268
diethyl oxalate;1,9,12,17-tetrazatricyclo[10.2.2.13,7]heptadeca-3,5,7(17)-triene-13,14-dione;3,9,15-triazabicyclo[9.3.1]pentadeca-1(15),11,13-triene (PubChem CID 162225268) has the molecular formula C31H45N7O6 and a molecular weight of 611.74 g/mol. Its IUPAC name is diethyl oxalate;1,9,12,17-tetrazatricyclo[10.2.2.13,7]heptadeca-3,5,7(17)-triene-13,14-dione;3,9,15-triazabicyclo[9.3.1]pentadeca-1(15),11,13-triene.
| Compound Name | diethyl oxalate;1,9,12,17-tetrazatricyclo[10.2.2.13,7]heptadeca-3,5,7(17)-triene-13,14-dione;3,9,15-triazabicyclo[9.3.1]pentadeca-1(15),11,13-triene |
|---|---|
| PubChem CID | 162225268 |
| Molecular Formula | C31H45N7O6 |
| Molecular Weight | 611.74 g/mol |
| Exact Mass | 611.34 |
| IUPAC Name | diethyl oxalate;1,9,12,17-tetrazatricyclo[10.2.2.13,7]heptadeca-3,5,7(17)-triene-13,14-dione;3,9,15-triazabicyclo[9.3.1]pentadeca-1(15),11,13-triene |
| SMILES | CCOC(=O)C(=O)OCC.O=C1C(=O)N2CCN1CCNCc1cccc(n1)C2.c1cc2nc(c1)CNCCCCCNC2 |
| InChI | InChI=1S/C13H16N4O2.C12H19N3.C6H10O4/c18-12-13(19)17-7-6-16(12)5-4-14-8-10-2-1-3-11(9-17)15-10;1-2-7-13-9-11-5-4-6-12(15-11)10-14-8-3-1;1-3-9-5(7)6(8)10-4-2/h1-3,14H,4-9H2;4-6,13-14H,1-3,7-10H2;3-4H2,1-2H3 |
| InChIKey | ZURBUSBDEATNBD-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 155.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.74 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|