C13H18N4O — CID 137393074
1,9,12,17-tetrazatricyclo[10.2.2.13,7]heptadeca-3,5,7(17)-trien-14-one (PubChem CID 137393074) has the molecular formula C13H18N4O and a molecular weight of 246.31 g/mol. Its IUPAC name is 1,9,12,17-tetrazatricyclo[10.2.2.13,7]heptadeca-3,5,7(17)-trien-14-one.
| Compound Name | 1,9,12,17-tetrazatricyclo[10.2.2.13,7]heptadeca-3,5,7(17)-trien-14-one |
|---|---|
| PubChem CID | 137393074 |
| Molecular Formula | C13H18N4O |
| Molecular Weight | 246.31 g/mol |
| Exact Mass | 246.15 |
| IUPAC Name | 1,9,12,17-tetrazatricyclo[10.2.2.13,7]heptadeca-3,5,7(17)-trien-14-one |
| SMILES | O=C1CN2CCNCc3cccc(n3)CN1CC2 |
| InChI | InChI=1S/C13H18N4O/c18-13-10-16-5-4-14-8-11-2-1-3-12(15-11)9-17(13)7-6-16/h1-3,14H,4-10H2 |
| InChIKey | OHNNULWTWBORCM-UHFFFAOYSA-N |
| XLogP | -0.17 |
| TPSA | 48.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.31 |
| LogP ≤ 5 | -0.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |