C14H16Cl3FeN4 — CID 11395537
3,11,17,18-tetrazatricyclo[11.3.1.15,9]octadeca-1(17),5(18),6,8,13,15-hexaene;trichloroiron (PubChem CID 11395537) has the molecular formula C14H16Cl3FeN4 and a molecular weight of 402.51 g/mol. Its IUPAC name is 3,11,17,18-tetrazatricyclo[11.3.1.15,9]octadeca-1(17),5(18),6,8,13,15-hexaene;trichloroiron.
| Compound Name | 3,11,17,18-tetrazatricyclo[11.3.1.15,9]octadeca-1(17),5(18),6,8,13,15-hexaene;trichloroiron |
|---|---|
| PubChem CID | 11395537 |
| Molecular Formula | C14H16Cl3FeN4 |
| Molecular Weight | 402.51 g/mol |
| Exact Mass | 400.98 |
| IUPAC Name | 3,11,17,18-tetrazatricyclo[11.3.1.15,9]octadeca-1(17),5(18),6,8,13,15-hexaene;trichloroiron |
| SMILES | Cl[Fe](Cl)Cl.c1cc2nc(c1)CNCc1cccc(n1)CNC2 |
| InChI | InChI=1S/C14H16N4.3ClH.Fe/c1-3-11-7-15-9-13-5-2-6-14(18-13)10-16-8-12(4-1)17-11;;;;/h1-6,15-16H,7-10H2;3*1H;/q;;;;+3/p-3 |
| InChIKey | NSWNTYVUUKVLRT-UHFFFAOYSA-K |
| XLogP | 3.44 |
| TPSA | 49.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.51 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|