C10H24O6Si — CID 162225478
2-methylprop-2-enoic acid;silane;3,3,3-trimethoxypropan-1-ol (PubChem CID 162225478) has the molecular formula C10H24O6Si and a molecular weight of 268.38 g/mol. Its IUPAC name is 2-methylprop-2-enoic acid;silane;3,3,3-trimethoxypropan-1-ol.
| Compound Name | 2-methylprop-2-enoic acid;silane;3,3,3-trimethoxypropan-1-ol |
|---|---|
| PubChem CID | 162225478 |
| Molecular Formula | C10H24O6Si |
| Molecular Weight | 268.38 g/mol |
| Exact Mass | 268.13 |
| IUPAC Name | 2-methylprop-2-enoic acid;silane;3,3,3-trimethoxypropan-1-ol |
| SMILES | C=C(C)C(=O)O.COC(CCO)(OC)OC.[SiH4] |
| InChI | InChI=1S/C6H14O4.C4H6O2.H4Si/c1-8-6(9-2,10-3)4-5-7;1-3(2)4(5)6;/h7H,4-5H2,1-3H3;1H2,2H3,(H,5,6);1H4 |
| InChIKey | ZURWHYVGAWPKRD-UHFFFAOYSA-N |
| XLogP | -0.84 |
| TPSA | 85.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.38 |
| LogP ≤ 5 | -0.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|