C12H16N2O4S — CID 162230709
1-[3-ethenyl-4-(methanesulfonamido)phenyl]ethylcarbamic acid (PubChem CID 162230709) has the molecular formula C12H16N2O4S and a molecular weight of 284.34 g/mol. Its IUPAC name is 1-[3-ethenyl-4-(methanesulfonamido)phenyl]ethylcarbamic acid.
| Compound Name | 1-[3-ethenyl-4-(methanesulfonamido)phenyl]ethylcarbamic acid |
|---|---|
| PubChem CID | 162230709 |
| Molecular Formula | C12H16N2O4S |
| Molecular Weight | 284.34 g/mol |
| Exact Mass | 284.08 |
| IUPAC Name | 1-[3-ethenyl-4-(methanesulfonamido)phenyl]ethylcarbamic acid |
| SMILES | C=Cc1cc(C(C)NC(=O)O)ccc1NS(C)(=O)=O |
| InChI | InChI=1S/C12H16N2O4S/c1-4-9-7-10(8(2)13-12(15)16)5-6-11(9)14-19(3,17)18/h4-8,13-14H,1H2,2-3H3,(H,15,16) |
| InChIKey | VNTWEVULHAMHFQ-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.34 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |