C17H24N2O4S — CID 76587252
tert-butyl N-[1-[3-ethenyl-4-(ethenylsulfonylamino)phenyl]ethyl]carbamate (PubChem CID 76587252) has the molecular formula C17H24N2O4S and a molecular weight of 352.46 g/mol. Its IUPAC name is tert-butyl N-[1-[3-ethenyl-4-(ethenylsulfonylamino)phenyl]ethyl]carbamate.
| Compound Name | tert-butyl N-[1-[3-ethenyl-4-(ethenylsulfonylamino)phenyl]ethyl]carbamate |
|---|---|
| PubChem CID | 76587252 |
| Molecular Formula | C17H24N2O4S |
| Molecular Weight | 352.46 g/mol |
| Exact Mass | 352.15 |
| IUPAC Name | tert-butyl N-[1-[3-ethenyl-4-(ethenylsulfonylamino)phenyl]ethyl]carbamate |
| SMILES | C=Cc1cc(C(C)NC(=O)OC(C)(C)C)ccc1NS(=O)(=O)C=C |
| InChI | InChI=1S/C17H24N2O4S/c1-7-13-11-14(9-10-15(13)19-24(21,22)8-2)12(3)18-16(20)23-17(4,5)6/h7-12,19H,1-2H2,3-6H3,(H,18,20) |
| InChIKey | MRTDTMUCFHWSSB-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.46 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |