C56H47F3O9S4 — CID 162232322
bis[4-(2,4-dimethylphenyl)sulfonylphenyl]-[2-methoxy-5-[9-(4-methoxyphenyl)fluoren-9-yl]phenyl]sulfanium;trifluoromethanesulfonate (PubChem CID 162232322) has the molecular formula C56H47F3O9S4 and a molecular weight of 1049.24 g/mol. Its IUPAC name is bis[4-(2,4-dimethylphenyl)sulfonylphenyl]-[2-methoxy-5-[9-(4-methoxyphenyl)fluoren-9-yl]phenyl]sulfanium;trifluoromethanesulfonate.
| Compound Name | bis[4-(2,4-dimethylphenyl)sulfonylphenyl]-[2-methoxy-5-[9-(4-methoxyphenyl)fluoren-9-yl]phenyl]sulfanium;trifluoromethanesulfonate |
|---|---|
| PubChem CID | 162232322 |
| Molecular Formula | C56H47F3O9S4 |
| Molecular Weight | 1049.24 g/mol |
| Exact Mass | 1048.21 |
| IUPAC Name | bis[4-(2,4-dimethylphenyl)sulfonylphenyl]-[2-methoxy-5-[9-(4-methoxyphenyl)fluoren-9-yl]phenyl]sulfanium;trifluoromethanesulfonate |
| SMILES | COc1ccc(C2(c3ccc(OC)c([S+](c4ccc(S(=O)(=O)c5ccc(C)cc5C)cc4)c4ccc(S(=O)(=O)c5ccc(C)cc5C)cc4)c3)c3ccccc3-c3ccccc32)cc1.O=S(=O)([O-])C(F)(F)F |
| InChI | InChI=1S/C55H47O6S3.CHF3O3S/c1-36-15-31-53(38(3)33-36)63(56,57)45-26-22-43(23-27-45)62(44-24-28-46(29-25-44)64(58,59)54-32-16-37(2)34-39(54)4)52-35-41(19-30-51(52)61-6)55(40-17-20-42(60-5)21-18-40)49-13-9-7-11-47(49)48-12-8-10-14-50(48)55;2-1(3,4)8(5,6)7/h7-35H,1-6H3;(H,5,6,7)/q+1;/p-1 |
| InChIKey | ZVPBPRBTNBLIBZ-UHFFFAOYSA-M |
| XLogP | 12.11 |
| TPSA | 143.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 72 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1049.24 |
| LogP ≤ 5 | 12.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|