About bis(2,3-dimethylbut-2-ene);methane
bis(2,3-dimethylbut-2-ene);methane (PubChem CID 162234102) has the molecular formula C13H28
and a molecular weight of 184.37 g/mol. Its IUPAC name is bis(2,3-dimethylbut-2-ene);methane.
Molecular Properties
| Compound Name | bis(2,3-dimethylbut-2-ene);methane |
| PubChem CID | 162234102 |
| Molecular Formula | C13H28 |
| Molecular Weight | 184.37 g/mol |
| Exact Mass | 184.22 |
| IUPAC Name | bis(2,3-dimethylbut-2-ene);methane |
| SMILES | C.CC(C)=C(C)C.CC(C)=C(C)C |
| InChI | InChI=1S/2C6H12.CH4/c2*1-5(2)6(3)4;/h2*1-4H3;1H4 |
| InChIKey | ZVVHTRRDZRWBCO-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 184.37 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze bis(2,3-dimethylbut-2-ene);methane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(2,3-dimethylbut-2-ene);methane?
The IUPAC name of bis(2,3-dimethylbut-2-ene);methane (CID 162234102) is bis(2,3-dimethylbut-2-ene);methane.
What is the SMILES notation for bis(2,3-dimethylbut-2-ene);methane?
The canonical SMILES for bis(2,3-dimethylbut-2-ene);methane is C.CC(C)=C(C)C.CC(C)=C(C)C.
What is the InChIKey of bis(2,3-dimethylbut-2-ene);methane?
The InChIKey is ZVVHTRRDZRWBCO-UHFFFAOYSA-N. The full InChI is InChI=1S/2C6H12.CH4/c2*1-5(2)6(3)4;/h2*1-4H3;1H4.
What are the key properties of bis(2,3-dimethylbut-2-ene);methane?
bis(2,3-dimethylbut-2-ene);methane has a molecular weight of 184.37 g/mol, XLogP of 5.36, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for bis(2,3-dimethylbut-2-ene);methane is sourced from PubChem (CID 162234102), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).