About actinium;3-methylbut-2-en-2-ol
actinium;3-methylbut-2-en-2-ol (PubChem CID 22892781) has the molecular formula C5H10AcO
and a molecular weight of 313.13 g/mol. Its IUPAC name is actinium;3-methylbut-2-en-2-ol.
Molecular Properties
| Compound Name | actinium;3-methylbut-2-en-2-ol |
| PubChem CID | 22892781 |
| Molecular Formula | C5H10AcO |
| Molecular Weight | 313.13 g/mol |
| Exact Mass | 313.10 |
| IUPAC Name | actinium;3-methylbut-2-en-2-ol |
| SMILES | CC(C)=C(C)O.[Ac] |
| InChI | InChI=1S/C5H10O.Ac/c1-4(2)5(3)6;/h6H,1-3H3; |
| InChIKey | NAWFIVOJEAXUKU-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 313.13 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|
Analyze actinium;3-methylbut-2-en-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of actinium;3-methylbut-2-en-2-ol?
The IUPAC name of actinium;3-methylbut-2-en-2-ol (CID 22892781) is actinium;3-methylbut-2-en-2-ol.
What is the SMILES notation for actinium;3-methylbut-2-en-2-ol?
The canonical SMILES for actinium;3-methylbut-2-en-2-ol is CC(C)=C(C)O.[Ac].
What is the InChIKey of actinium;3-methylbut-2-en-2-ol?
The InChIKey is NAWFIVOJEAXUKU-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H10O.Ac/c1-4(2)5(3)6;/h6H,1-3H3;.
What are the key properties of actinium;3-methylbut-2-en-2-ol?
actinium;3-methylbut-2-en-2-ol has a molecular weight of 313.13 g/mol, XLogP of 1.86, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for actinium;3-methylbut-2-en-2-ol is sourced from PubChem (CID 22892781), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).