C28H40N4O2 — CID 162234128
6-cyclohexyl-1-[4-[[(4-methyl-6-morpholin-4-ylpyrimidin-2-yl)amino]methyl]phenyl]hexan-1-one (PubChem CID 162234128) has the molecular formula C28H40N4O2 and a molecular weight of 464.65 g/mol. Its IUPAC name is 6-cyclohexyl-1-[4-[[(4-methyl-6-morpholin-4-ylpyrimidin-2-yl)amino]methyl]phenyl]hexan-1-one.
| Compound Name | 6-cyclohexyl-1-[4-[[(4-methyl-6-morpholin-4-ylpyrimidin-2-yl)amino]methyl]phenyl]hexan-1-one |
|---|---|
| PubChem CID | 162234128 |
| Molecular Formula | C28H40N4O2 |
| Molecular Weight | 464.65 g/mol |
| Exact Mass | 464.32 |
| IUPAC Name | 6-cyclohexyl-1-[4-[[(4-methyl-6-morpholin-4-ylpyrimidin-2-yl)amino]methyl]phenyl]hexan-1-one |
| SMILES | Cc1cc(N2CCOCC2)nc(NCc2ccc(C(=O)CCCCCC3CCCCC3)cc2)n1 |
| InChI | InChI=1S/C28H40N4O2/c1-22-20-27(32-16-18-34-19-17-32)31-28(30-22)29-21-24-12-14-25(15-13-24)26(33)11-7-3-6-10-23-8-4-2-5-9-23/h12-15,20,23H,2-11,16-19,21H2,1H3,(H,29,30,31) |
| InChIKey | RXSFIOJOBONAEW-UHFFFAOYSA-N |
| XLogP | 5.95 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.65 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|