About ethane;methane;(2R)-3-sulfanyl-2-(sulfanylamino)propanal
ethane;methane;(2R)-3-sulfanyl-2-(sulfanylamino)propanal (PubChem CID 162238381) has the molecular formula C6H17NOS2
and a molecular weight of 183.34 g/mol. Its IUPAC name is ethane;methane;(2R)-3-sulfanyl-2-(sulfanylamino)propanal.
Molecular Properties
| Compound Name | ethane;methane;(2R)-3-sulfanyl-2-(sulfanylamino)propanal |
| PubChem CID | 162238381 |
| Molecular Formula | C6H17NOS2 |
| Molecular Weight | 183.34 g/mol |
| Exact Mass | 183.08 |
| IUPAC Name | ethane;methane;(2R)-3-sulfanyl-2-(sulfanylamino)propanal |
| SMILES | C.CC.O=C[C@H](CS)NS |
| InChI | InChI=1S/C3H7NOS2.C2H6.CH4/c5-1-3(2-6)4-7;1-2;/h1,3-4,6-7H,2H2;1-2H3;1H4/t3-;;/m1../s1 |
| InChIKey | ZWJHANMBNQMJMZ-HWYNEVGZSA-N |
| XLogP | 1.58 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 183.34 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze ethane;methane;(2R)-3-sulfanyl-2-(sulfanylamino)propanal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;methane;(2R)-3-sulfanyl-2-(sulfanylamino)propanal?
The IUPAC name of ethane;methane;(2R)-3-sulfanyl-2-(sulfanylamino)propanal (CID 162238381) is ethane;methane;(2R)-3-sulfanyl-2-(sulfanylamino)propanal.
What is the SMILES notation for ethane;methane;(2R)-3-sulfanyl-2-(sulfanylamino)propanal?
The canonical SMILES for ethane;methane;(2R)-3-sulfanyl-2-(sulfanylamino)propanal is C.CC.O=C[C@H](CS)NS.
What is the InChIKey of ethane;methane;(2R)-3-sulfanyl-2-(sulfanylamino)propanal?
The InChIKey is ZWJHANMBNQMJMZ-HWYNEVGZSA-N. The full InChI is InChI=1S/C3H7NOS2.C2H6.CH4/c5-1-3(2-6)4-7;1-2;/h1,3-4,6-7H,2H2;1-2H3;1H4/t3-;;/m1../s1.
What are the key properties of ethane;methane;(2R)-3-sulfanyl-2-(sulfanylamino)propanal?
ethane;methane;(2R)-3-sulfanyl-2-(sulfanylamino)propanal has a molecular weight of 183.34 g/mol, XLogP of 1.58, 3 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;methane;(2R)-3-sulfanyl-2-(sulfanylamino)propanal is sourced from PubChem (CID 162238381), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).