C10H18N4O4S2 — CID 134817549
(2R)-2-[(2-aminoacetyl)amino]-N-[2-oxo-2-[[(2R)-1-oxo-3-sulfanylpropan-2-yl]amino]ethyl]-3-sulfanylpropanamide (PubChem CID 134817549) has the molecular formula C10H18N4O4S2 and a molecular weight of 322.41 g/mol. Its IUPAC name is (2R)-2-[(2-aminoacetyl)amino]-N-[2-oxo-2-[[(2R)-1-oxo-3-sulfanylpropan-2-yl]amino]ethyl]-3-sulfanylpropanamide.
| Compound Name | (2R)-2-[(2-aminoacetyl)amino]-N-[2-oxo-2-[[(2R)-1-oxo-3-sulfanylpropan-2-yl]amino]ethyl]-3-sulfanylpropanamide |
|---|---|
| PubChem CID | 134817549 |
| Molecular Formula | C10H18N4O4S2 |
| Molecular Weight | 322.41 g/mol |
| Exact Mass | 322.08 |
| IUPAC Name | (2R)-2-[(2-aminoacetyl)amino]-N-[2-oxo-2-[[(2R)-1-oxo-3-sulfanylpropan-2-yl]amino]ethyl]-3-sulfanylpropanamide |
| SMILES | NCC(=O)N[C@@H](CS)C(=O)NCC(=O)N[C@H](C=O)CS |
| InChI | InChI=1S/C10H18N4O4S2/c11-1-8(16)14-7(5-20)10(18)12-2-9(17)13-6(3-15)4-19/h3,6-7,19-20H,1-2,4-5,11H2,(H,12,18)(H,13,17)(H,14,16)/t6-,7+/m1/s1 |
| InChIKey | KEADZIDRLJNHQJ-RQJHMYQMSA-N |
| XLogP | -2.91 |
| TPSA | 130.39 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.41 |
| LogP ≤ 5 | -2.91 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|