C10H20N4O3S — CID 123492581
2-[(2-aminoacetyl)amino]-N-[2-oxo-2-(2-sulfanylethylamino)ethyl]butanamide (PubChem CID 123492581) has the molecular formula C10H20N4O3S and a molecular weight of 276.36 g/mol. Its IUPAC name is 2-[(2-aminoacetyl)amino]-N-[2-oxo-2-(2-sulfanylethylamino)ethyl]butanamide.
| Compound Name | 2-[(2-aminoacetyl)amino]-N-[2-oxo-2-(2-sulfanylethylamino)ethyl]butanamide |
|---|---|
| PubChem CID | 123492581 |
| Molecular Formula | C10H20N4O3S |
| Molecular Weight | 276.36 g/mol |
| Exact Mass | 276.13 |
| IUPAC Name | 2-[(2-aminoacetyl)amino]-N-[2-oxo-2-(2-sulfanylethylamino)ethyl]butanamide |
| SMILES | CCC(NC(=O)CN)C(=O)NCC(=O)NCCS |
| InChI | InChI=1S/C10H20N4O3S/c1-2-7(14-8(15)5-11)10(17)13-6-9(16)12-3-4-18/h7,18H,2-6,11H2,1H3,(H,12,16)(H,13,17)(H,14,15) |
| InChIKey | YXVAYOIWDJYDAF-UHFFFAOYSA-N |
| XLogP | -2.00 |
| TPSA | 113.32 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.36 |
| LogP ≤ 5 | -2.00 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|