C14H29NO — CID 162238862
methane;(1R,2R,4S)-1-methyl-2-(propan-2-ylamino)-4-prop-1-en-2-ylcyclohexan-1-ol (PubChem CID 162238862) has the molecular formula C14H29NO and a molecular weight of 227.39 g/mol. Its IUPAC name is methane;(1R,2R,4S)-1-methyl-2-(propan-2-ylamino)-4-prop-1-en-2-ylcyclohexan-1-ol.
| Compound Name | methane;(1R,2R,4S)-1-methyl-2-(propan-2-ylamino)-4-prop-1-en-2-ylcyclohexan-1-ol |
|---|---|
| PubChem CID | 162238862 |
| Molecular Formula | C14H29NO |
| Molecular Weight | 227.39 g/mol |
| Exact Mass | 227.22 |
| IUPAC Name | methane;(1R,2R,4S)-1-methyl-2-(propan-2-ylamino)-4-prop-1-en-2-ylcyclohexan-1-ol |
| SMILES | C.C=C(C)[C@H]1CC[C@@](C)(O)[C@H](NC(C)C)C1 |
| InChI | InChI=1S/C13H25NO.CH4/c1-9(2)11-6-7-13(5,15)12(8-11)14-10(3)4;/h10-12,14-15H,1,6-8H2,2-5H3;1H4/t11-,12+,13+;/m0./s1 |
| InChIKey | ZWKXILUFHWQROP-LUHWTZLKSA-N |
| XLogP | 3.12 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.39 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|