C29H53N9O3Zn2 — CID 162239218
(2S)-1-(1H-imidazol-2-yl)-2-(methylamino)pentan-3-one;bis((2S)-2-(1H-imidazol-2-ylmethyl)-N-methylbutanamide);methane;zinc (PubChem CID 162239218) has the molecular formula C29H53N9O3Zn2 and a molecular weight of 706.58 g/mol. Its IUPAC name is (2S)-1-(1H-imidazol-2-yl)-2-(methylamino)pentan-3-one;bis((2S)-2-(1H-imidazol-2-ylmethyl)-N-methylbutanamide);methane;zinc.
| Compound Name | (2S)-1-(1H-imidazol-2-yl)-2-(methylamino)pentan-3-one;bis((2S)-2-(1H-imidazol-2-ylmethyl)-N-methylbutanamide);methane;zinc |
|---|---|
| PubChem CID | 162239218 |
| Molecular Formula | C29H53N9O3Zn2 |
| Molecular Weight | 706.58 g/mol |
| Exact Mass | 703.29 |
| IUPAC Name | (2S)-1-(1H-imidazol-2-yl)-2-(methylamino)pentan-3-one;bis((2S)-2-(1H-imidazol-2-ylmethyl)-N-methylbutanamide);methane;zinc |
| SMILES | C.C.CCC(=O)[C@H](Cc1ncc[nH]1)NC.CC[C@@H](Cc1ncc[nH]1)C(=O)NC.CC[C@@H](Cc1ncc[nH]1)C(=O)NC.[Zn].[Zn] |
| InChI | InChI=1S/3C9H15N3O.2CH4.2Zn/c1-3-8(13)7(10-2)6-9-11-4-5-12-9;2*1-3-7(9(13)10-2)6-8-11-4-5-12-8;;;;/h4-5,7,10H,3,6H2,1-2H3,(H,11,12);2*4-5,7H,3,6H2,1-2H3,(H,10,13)(H,11,12);2*1H4;;/t3*7-;;;;/m000..../s1 |
| InChIKey | ZWMAMRKKZZQUQZ-GKCYKVBLSA-N |
| XLogP | 3.24 |
| TPSA | 173.34 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 706.58 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|