C17H22ClNO4 — CID 162242114
ethyl 3-[[(4S)-5-(4-chlorophenyl)-4-methyl-2-oxopentyl]amino]-3-oxopropanoate (PubChem CID 162242114) has the molecular formula C17H22ClNO4 and a molecular weight of 339.82 g/mol. Its IUPAC name is ethyl 3-[[(4S)-5-(4-chlorophenyl)-4-methyl-2-oxopentyl]amino]-3-oxopropanoate.
| Compound Name | ethyl 3-[[(4S)-5-(4-chlorophenyl)-4-methyl-2-oxopentyl]amino]-3-oxopropanoate |
|---|---|
| PubChem CID | 162242114 |
| Molecular Formula | C17H22ClNO4 |
| Molecular Weight | 339.82 g/mol |
| Exact Mass | 339.12 |
| IUPAC Name | ethyl 3-[[(4S)-5-(4-chlorophenyl)-4-methyl-2-oxopentyl]amino]-3-oxopropanoate |
| SMILES | CCOC(=O)CC(=O)NCC(=O)C[C@@H](C)Cc1ccc(Cl)cc1 |
| InChI | InChI=1S/C17H22ClNO4/c1-3-23-17(22)10-16(21)19-11-15(20)9-12(2)8-13-4-6-14(18)7-5-13/h4-7,12H,3,8-11H2,1-2H3,(H,19,21)/t12-/m0/s1 |
| InChIKey | ZWVNXODPGKXAQW-LBPRGKRZSA-N |
| XLogP | 2.55 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.82 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|