C16H30O4 — CID 162244216
3,3-dimethyloxetane;2,3-dimethyloxirane;methyl 2,3-dimethylbut-2-enoate (PubChem CID 162244216) has the molecular formula C16H30O4 and a molecular weight of 286.41 g/mol. Its IUPAC name is 3,3-dimethyloxetane;2,3-dimethyloxirane;methyl 2,3-dimethylbut-2-enoate.
| Compound Name | 3,3-dimethyloxetane;2,3-dimethyloxirane;methyl 2,3-dimethylbut-2-enoate |
|---|---|
| PubChem CID | 162244216 |
| Molecular Formula | C16H30O4 |
| Molecular Weight | 286.41 g/mol |
| Exact Mass | 286.21 |
| IUPAC Name | 3,3-dimethyloxetane;2,3-dimethyloxirane;methyl 2,3-dimethylbut-2-enoate |
| SMILES | CC1(C)COC1.CC1OC1C.COC(=O)C(C)=C(C)C |
| InChI | InChI=1S/C7H12O2.C5H10O.C4H8O/c1-5(2)6(3)7(8)9-4;1-5(2)3-6-4-5;1-3-4(2)5-3/h1-4H3;3-4H2,1-2H3;3-4H,1-2H3 |
| InChIKey | ZXCOBPONRWHWFH-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 48.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.41 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|